C13H28N4 — CID 82511442
1-methyl-4-(1-piperazin-1-ylpropan-2-yl)-1,4-diazepane (PubChem CID 82511442) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-methyl-4-(1-piperazin-1-ylpropan-2-yl)-1,4-diazepane.
| Compound Name | 1-methyl-4-(1-piperazin-1-ylpropan-2-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 82511442 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | 1-methyl-4-(1-piperazin-1-ylpropan-2-yl)-1,4-diazepane |
| SMILES | CC(CN1CCNCC1)N1CCCN(C)CC1 |
| InChI | InChI=1S/C13H28N4/c1-13(12-16-8-4-14-5-9-16)17-7-3-6-15(2)10-11-17/h13-14H,3-12H2,1-2H3 |
| InChIKey | RAFYHTAAQBNYNX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |