About N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine
N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine (PubChem CID 62418612) has the molecular formula C10H23N3
and a molecular weight of 185.31 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine.
Analyze N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine?
The IUPAC name of N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine (CID 62418612) is N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine.
What is the SMILES notation for N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine?
The canonical SMILES for N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine is CNCC(C)N1CCCN(C)CC1.
What is the InChIKey of N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine?
The InChIKey is RKYXLOMRTSAVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3/c1-10(9-11-2)13-6-4-5-12(3)7-8-13/h10-11H,4-9H2,1-3H3.
What are the key properties of N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine?
N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine has a molecular weight of 185.31 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(4-methyl-1,4-diazepan-1-yl)propan-1-amine is sourced from PubChem (CID 62418612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).