C12H23N3 — CID 62558175
2-(4-methyl-1,4-diazepan-1-yl)-N-prop-2-ynylpropan-1-amine (PubChem CID 62558175) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazepan-1-yl)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 2-(4-methyl-1,4-diazepan-1-yl)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 62558175 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-(4-methyl-1,4-diazepan-1-yl)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C12H23N3/c1-4-6-13-11-12(2)15-8-5-7-14(3)9-10-15/h1,12-13H,5-11H2,2-3H3 |
| InChIKey | NRPIRGNXXGQMLV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|