C9H20N2S — CID 62411870
N-methyl-2-(1,4-thiazepan-4-yl)propan-1-amine (PubChem CID 62411870) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is N-methyl-2-(1,4-thiazepan-4-yl)propan-1-amine.
| Compound Name | N-methyl-2-(1,4-thiazepan-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 62411870 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-methyl-2-(1,4-thiazepan-4-yl)propan-1-amine |
| SMILES | CNCC(C)N1CCCSCC1 |
| InChI | InChI=1S/C9H20N2S/c1-9(8-10-2)11-4-3-6-12-7-5-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | QCZSGPRBPWLZOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |