C10H22N2 — CID 58719890
1-methyl-4-(2-methylpropyl)-1,4-diazepane (PubChem CID 58719890) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-methyl-4-(2-methylpropyl)-1,4-diazepane.
| Compound Name | 1-methyl-4-(2-methylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 58719890 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-methyl-4-(2-methylpropyl)-1,4-diazepane |
| SMILES | CC(C)CN1CCCN(C)CC1 |
| InChI | InChI=1S/C10H22N2/c1-10(2)9-12-6-4-5-11(3)7-8-12/h10H,4-9H2,1-3H3 |
| InChIKey | XTCUKAMFTTXKLI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |