C8H16F2N2 — CID 129297477
1-(2,2-difluoroethyl)-4-methyl-1,4-diazepane (PubChem CID 129297477) has the molecular formula C8H16F2N2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-methyl-1,4-diazepane.
| Compound Name | 1-(2,2-difluoroethyl)-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 129297477 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(CC(F)F)CC1 |
| InChI | InChI=1S/C8H16F2N2/c1-11-3-2-4-12(6-5-11)7-8(9)10/h8H,2-7H2,1H3 |
| InChIKey | YQPXRXJNEABCCC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |