C7H14F2N2 — CID 76646739
1-(2,2-difluoroethyl)-4-methylpiperazine (PubChem CID 76646739) has the molecular formula C7H14F2N2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-methylpiperazine.
| Compound Name | 1-(2,2-difluoroethyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 76646739 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-methylpiperazine |
| SMILES | CN1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C7H14F2N2/c1-10-2-4-11(5-3-10)6-7(8)9/h7H,2-6H2,1H3 |
| InChIKey | JLCWXBGRAJJGPO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |