C13H27FeN3O2+4 — CID 153461646
iron(6+);(2S)-1-[4-methyl-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]propan-2-olate (PubChem CID 153461646) has the molecular formula C13H27FeN3O2+4 and a molecular weight of 313.22 g/mol. Its IUPAC name is iron(6+);(2S)-1-[4-methyl-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]propan-2-olate.
| Compound Name | iron(6+);(2S)-1-[4-methyl-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]propan-2-olate |
|---|---|
| PubChem CID | 153461646 |
| Molecular Formula | C13H27FeN3O2+4 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | iron(6+);(2S)-1-[4-methyl-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]propan-2-olate |
| SMILES | C[C@H]([O-])CN1CCN(C)CCN(C[C@H](C)[O-])CC1.[Fe+6] |
| InChI | InChI=1S/C13H27N3O2.Fe/c1-12(17)10-15-6-4-14(3)5-7-16(9-8-15)11-13(2)18;/h12-13H,4-11H2,1-3H3;/q-2;+6/t12-,13-;/m0./s1 |
| InChIKey | YUROWQWOMZMQIV-QNTKWALQSA-N |
| XLogP | -1.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|