C10H23N3 — CID 15461213
1,4,7-trimethyl-1,4,7-triazecane (PubChem CID 15461213) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1,4,7-trimethyl-1,4,7-triazecane.
| Compound Name | 1,4,7-trimethyl-1,4,7-triazecane |
|---|---|
| PubChem CID | 15461213 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1,4,7-trimethyl-1,4,7-triazecane |
| SMILES | CN1CCCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C10H23N3/c1-11-5-4-6-12(2)8-10-13(3)9-7-11/h4-10H2,1-3H3 |
| InChIKey | DEKIYHATMYCZIN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |