C14H32Cl2CuN4O8 — CID 71676779
copper;1,4,8,11-tetramethyl-1,4,8,11-tetrazacyclotetradecane;diperchlorate (PubChem CID 71676779) has the molecular formula C14H32Cl2CuN4O8 and a molecular weight of 518.88 g/mol. Its IUPAC name is copper;1,4,8,11-tetramethyl-1,4,8,11-tetrazacyclotetradecane;diperchlorate.
| Compound Name | copper;1,4,8,11-tetramethyl-1,4,8,11-tetrazacyclotetradecane;diperchlorate |
|---|---|
| PubChem CID | 71676779 |
| Molecular Formula | C14H32Cl2CuN4O8 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | copper;1,4,8,11-tetramethyl-1,4,8,11-tetrazacyclotetradecane;diperchlorate |
| SMILES | CN1CCCN(C)CCN(C)CCCN(C)CC1.[Cu+2].[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C14H32N4.2ClHO4.Cu/c1-15-7-5-8-17(3)13-14-18(4)10-6-9-16(2)12-11-15;2*2-1(3,4)5;/h5-14H2,1-4H3;2*(H,2,3,4,5);/q;;;+2/p-2 |
| InChIKey | ZLSRYJQXYGYFMQ-UHFFFAOYSA-L |
| XLogP | -9.01 |
| TPSA | 197.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | -9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |