C12H28N2 — CID 143609892
1,4-dimethyl-1,4-diazecane;ethane (PubChem CID 143609892) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 1,4-dimethyl-1,4-diazecane;ethane.
| Compound Name | 1,4-dimethyl-1,4-diazecane;ethane |
|---|---|
| PubChem CID | 143609892 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 1,4-dimethyl-1,4-diazecane;ethane |
| SMILES | CC.CN1CCCCCCN(C)CC1 |
| InChI | InChI=1S/C10H22N2.C2H6/c1-11-7-5-3-4-6-8-12(2)10-9-11;1-2/h3-10H2,1-2H3;1-2H3 |
| InChIKey | APKKWCOVRJJYTG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |