C16H39N3 — CID 170707096
1,4-dimethylpiperazine;ethane;1-methylpiperidine (PubChem CID 170707096) has the molecular formula C16H39N3 and a molecular weight of 273.51 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;ethane;1-methylpiperidine.
| Compound Name | 1,4-dimethylpiperazine;ethane;1-methylpiperidine |
|---|---|
| PubChem CID | 170707096 |
| Molecular Formula | C16H39N3 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 273.31 |
| IUPAC Name | 1,4-dimethylpiperazine;ethane;1-methylpiperidine |
| SMILES | CC.CC.CN1CCCCC1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2.C6H13N.2C2H6/c1-7-3-5-8(2)6-4-7;1-7-5-3-2-4-6-7;2*1-2/h3-6H2,1-2H3;2-6H2,1H3;2*1-2H3 |
| InChIKey | ZWHPWGARHHDZSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |