About 1-ethylpiperazine;1-propan-2-ylpiperazine
1-ethylpiperazine;1-propan-2-ylpiperazine (PubChem CID 70370755) has the molecular formula C13H30N4
and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-ethylpiperazine;1-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | 1-ethylpiperazine;1-propan-2-ylpiperazine |
| PubChem CID | 70370755 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | 1-ethylpiperazine;1-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCNCC1.CCN1CCNCC1 |
| InChI | InChI=1S/C7H16N2.C6H14N2/c1-7(2)9-5-3-8-4-6-9;1-2-8-5-3-7-4-6-8/h7-8H,3-6H2,1-2H3;7H,2-6H2,1H3 |
| InChIKey | SICUUCYAEUALLO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethylpiperazine;1-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpiperazine;1-propan-2-ylpiperazine?
The IUPAC name of 1-ethylpiperazine;1-propan-2-ylpiperazine (CID 70370755) is 1-ethylpiperazine;1-propan-2-ylpiperazine.
What is the SMILES notation for 1-ethylpiperazine;1-propan-2-ylpiperazine?
The canonical SMILES for 1-ethylpiperazine;1-propan-2-ylpiperazine is CC(C)N1CCNCC1.CCN1CCNCC1.
What is the InChIKey of 1-ethylpiperazine;1-propan-2-ylpiperazine?
The InChIKey is SICUUCYAEUALLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C6H14N2/c1-7(2)9-5-3-8-4-6-9;1-2-8-5-3-7-4-6-8/h7-8H,3-6H2,1-2H3;7H,2-6H2,1H3.
What are the key properties of 1-ethylpiperazine;1-propan-2-ylpiperazine?
1-ethylpiperazine;1-propan-2-ylpiperazine has a molecular weight of 242.41 g/mol, XLogP of 0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpiperazine;1-propan-2-ylpiperazine is sourced from PubChem (CID 70370755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).