C13H26FN3 — CID 170952005
1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]piperazine (PubChem CID 170952005) has the molecular formula C13H26FN3 and a molecular weight of 243.37 g/mol. Its IUPAC name is 1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]piperazine.
| Compound Name | 1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 170952005 |
| Molecular Formula | C13H26FN3 |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | 1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]piperazine |
| SMILES | CC(C)N1CCC(F)(CN2CCNCC2)CC1 |
| InChI | InChI=1S/C13H26FN3/c1-12(2)17-7-3-13(14,4-8-17)11-16-9-5-15-6-10-16/h12,15H,3-11H2,1-2H3 |
| InChIKey | RXOIAGKFNBTUMO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |