C17H30FIN2 — CID 176563302
7-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-2-iodo-7-azaspiro[3.5]nonane (PubChem CID 176563302) has the molecular formula C17H30FIN2 and a molecular weight of 408.34 g/mol. Its IUPAC name is 7-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-2-iodo-7-azaspiro[3.5]nonane.
| Compound Name | 7-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-2-iodo-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 176563302 |
| Molecular Formula | C17H30FIN2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 7-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-2-iodo-7-azaspiro[3.5]nonane |
| SMILES | CC(C)N1CCC(F)(CN2CCC3(CC2)CC(I)C3)CC1 |
| InChI | InChI=1S/C17H30FIN2/c1-14(2)21-9-5-17(18,6-10-21)13-20-7-3-16(4-8-20)11-15(19)12-16/h14-15H,3-13H2,1-2H3 |
| InChIKey | RJSBGNMPJCWFAH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|