C15H28FN3O — CID 166113547
1-[4-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]ethanone (PubChem CID 166113547) has the molecular formula C15H28FN3O and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-[4-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166113547 |
| Molecular Formula | C15H28FN3O |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 1-[4-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(F)(CN2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C15H28FN3O/c1-13(2)18-10-8-17(9-11-18)12-15(16)4-6-19(7-5-15)14(3)20/h13H,4-12H2,1-3H3 |
| InChIKey | KUJHMTGVCPRSJZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |