C22H43N3O3 — CID 172576329
ethane;1-[4-[(4-hydroxy-1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]heptane-1,6-dione (PubChem CID 172576329) has the molecular formula C22H43N3O3 and a molecular weight of 397.60 g/mol. Its IUPAC name is ethane;1-[4-[(4-hydroxy-1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]heptane-1,6-dione.
| Compound Name | ethane;1-[4-[(4-hydroxy-1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]heptane-1,6-dione |
|---|---|
| PubChem CID | 172576329 |
| Molecular Formula | C22H43N3O3 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | ethane;1-[4-[(4-hydroxy-1-propan-2-ylpiperidin-4-yl)methyl]piperazin-1-yl]heptane-1,6-dione |
| SMILES | CC.CC(=O)CCCCC(=O)N1CCN(CC2(O)CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O3.C2H6/c1-17(2)22-10-8-20(26,9-11-22)16-21-12-14-23(15-13-21)19(25)7-5-4-6-18(3)24;1-2/h17,26H,4-16H2,1-3H3;1-2H3 |
| InChIKey | KGFUXGRVRFBIGE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|