C12H27N3O — CID 170709333
ethane;N-methyl-2-(4-propan-2-ylpiperazin-1-yl)acetamide (PubChem CID 170709333) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is ethane;N-methyl-2-(4-propan-2-ylpiperazin-1-yl)acetamide.
| Compound Name | ethane;N-methyl-2-(4-propan-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 170709333 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | ethane;N-methyl-2-(4-propan-2-ylpiperazin-1-yl)acetamide |
| SMILES | CC.CNC(=O)CN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C10H21N3O.C2H6/c1-9(2)13-6-4-12(5-7-13)8-10(14)11-3;1-2/h9H,4-8H2,1-3H3,(H,11,14);1-2H3 |
| InChIKey | CDLKYCLTBKBMHI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |