C9H19N3O — CID 89043934
N-methyl-2-(4-methyl-1,4-diazepan-1-yl)acetamide (PubChem CID 89043934) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-1,4-diazepan-1-yl)acetamide.
| Compound Name | N-methyl-2-(4-methyl-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 89043934 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N-methyl-2-(4-methyl-1,4-diazepan-1-yl)acetamide |
| SMILES | CNC(=O)CN1CCCN(C)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-10-9(13)8-12-5-3-4-11(2)6-7-12/h3-8H2,1-2H3,(H,10,13) |
| InChIKey | QYJOXDQPSMYZAW-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |