C14H29N3OS — CID 50956247
N-(2-tert-butylsulfanylethyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide (PubChem CID 50956247) has the molecular formula C14H29N3OS and a molecular weight of 287.47 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 50956247 |
| Molecular Formula | C14H29N3OS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-(4-methyl-1,4-diazepan-1-yl)acetamide |
| SMILES | CN1CCCN(CC(=O)NCCSC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H29N3OS/c1-14(2,3)19-11-6-15-13(18)12-17-8-5-7-16(4)9-10-17/h5-12H2,1-4H3,(H,15,18) |
| InChIKey | CNJFNYZMQQFDNA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|