C11H24N4O2 — CID 175195064
N-[2-(2-aminoethoxy)ethyl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 175195064) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 175195064 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)NCCOCCN)CC1 |
| InChI | InChI=1S/C11H24N4O2/c1-14-4-6-15(7-5-14)10-11(16)13-3-9-17-8-2-12/h2-10,12H2,1H3,(H,13,16) |
| InChIKey | TYHTYJGPQHSKBV-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|