C15H31N3O4 — CID 164557571
N-[2-[2-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 164557571) has the molecular formula C15H31N3O4 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | N-[2-[2-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 164557571 |
| Molecular Formula | C15H31N3O4 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | N-[2-[2-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOCCOCCOCCN1CCN(C)CC1 |
| InChI | InChI=1S/C15H31N3O4/c1-15(19)16-3-9-20-11-13-22-14-12-21-10-8-18-6-4-17(2)5-7-18/h3-14H2,1-2H3,(H,16,19) |
| InChIKey | IAYIJJBLUWGHGW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|