C18H37N3O3 — CID 164535761
3-methyl-N-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethyl]butanamide (PubChem CID 164535761) has the molecular formula C18H37N3O3 and a molecular weight of 343.51 g/mol. Its IUPAC name is 3-methyl-N-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 3-methyl-N-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 164535761 |
| Molecular Formula | C18H37N3O3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | 3-methyl-N-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CC(C)CC(=O)NCCOCCOCCN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C18H37N3O3/c1-16(2)15-18(22)19-5-11-23-13-14-24-12-10-20-6-8-21(9-7-20)17(3)4/h16-17H,5-15H2,1-4H3,(H,19,22) |
| InChIKey | ORMGHAFPRLJJHD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|