C20H45N3O4 — CID 169215012
ethane;3-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide;molecular hydrogen (PubChem CID 169215012) has the molecular formula C20H45N3O4 and a molecular weight of 391.60 g/mol. Its IUPAC name is ethane;3-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide;molecular hydrogen.
| Compound Name | ethane;3-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 169215012 |
| Molecular Formula | C20H45N3O4 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.34 |
| IUPAC Name | ethane;3-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide;molecular hydrogen |
| SMILES | CC.CCC(C)CC(=O)NCCOCCOCCOCCN1CCNCC1.[H][H] |
| InChI | InChI=1S/C18H37N3O4.C2H6.H2/c1-3-17(2)16-18(22)20-6-10-23-12-14-25-15-13-24-11-9-21-7-4-19-5-8-21;1-2;/h17,19H,3-16H2,1-2H3,(H,20,22);1-2H3;1H |
| InChIKey | VLLPPFQOLOOADH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|