C10H20BrNO2 — CID 114876985
N-[2-(2-bromoethoxy)ethyl]-3-methylpentanamide (PubChem CID 114876985) has the molecular formula C10H20BrNO2 and a molecular weight of 266.18 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-3-methylpentanamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 114876985 |
| Molecular Formula | C10H20BrNO2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-3-methylpentanamide |
| SMILES | CCC(C)CC(=O)NCCOCCBr |
| InChI | InChI=1S/C10H20BrNO2/c1-3-9(2)8-10(13)12-5-7-14-6-4-11/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | VTLRWKFNJREZRJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|