C21H42N2O5 — CID 168959082
3-methyl-N-[2-[2-[2-[3-(4-methylpentylamino)-3-oxopropoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 168959082) has the molecular formula C21H42N2O5 and a molecular weight of 402.58 g/mol. Its IUPAC name is 3-methyl-N-[2-[2-[2-[3-(4-methylpentylamino)-3-oxopropoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 3-methyl-N-[2-[2-[2-[3-(4-methylpentylamino)-3-oxopropoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 168959082 |
| Molecular Formula | C21H42N2O5 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 3-methyl-N-[2-[2-[2-[3-(4-methylpentylamino)-3-oxopropoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CCC(C)CC(=O)NCCOCCOCCOCCC(=O)NCCCC(C)C |
| InChI | InChI=1S/C21H42N2O5/c1-5-19(4)17-21(25)23-10-12-27-14-16-28-15-13-26-11-8-20(24)22-9-6-7-18(2)3/h18-19H,5-17H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | OARCALDJWWJBKI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|