C19H36N2O7 — CID 145418064
3-methyl-N-[2-oxo-2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]pentanamide (PubChem CID 145418064) has the molecular formula C19H36N2O7 and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-methyl-N-[2-oxo-2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]pentanamide.
| Compound Name | 3-methyl-N-[2-oxo-2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]pentanamide |
|---|---|
| PubChem CID | 145418064 |
| Molecular Formula | C19H36N2O7 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 3-methyl-N-[2-oxo-2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]pentanamide |
| SMILES | CCC(C)CC(=O)NCC(=O)NCCOCCOCCOCCOCCC=O |
| InChI | InChI=1S/C19H36N2O7/c1-3-17(2)15-18(23)21-16-19(24)20-5-8-26-10-12-28-14-13-27-11-9-25-7-4-6-22/h6,17H,3-5,7-16H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | NFCJFLFLMZOMEB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|