C18H35NO9 — CID 171541655
3-hydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid;propane (PubChem CID 171541655) has the molecular formula C18H35NO9 and a molecular weight of 409.48 g/mol. Its IUPAC name is 3-hydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid;propane.
| Compound Name | 3-hydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid;propane |
|---|---|
| PubChem CID | 171541655 |
| Molecular Formula | C18H35NO9 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 3-hydroxy-4-oxo-4-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethylamino]butanoic acid;propane |
| SMILES | CCC.O=CCCOCCOCCOCCOCCNC(=O)C(O)CC(=O)O |
| InChI | InChI=1S/C15H27NO9.C3H8/c17-3-1-4-22-6-8-24-10-11-25-9-7-23-5-2-16-15(21)13(18)12-14(19)20;1-3-2/h3,13,18H,1-2,4-12H2,(H,16,21)(H,19,20);3H2,1-2H3 |
| InChIKey | JWWBYXQYVHUALL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|