C16H30O9 — CID 167163889
3-[2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 167163889) has the molecular formula C16H30O9 and a molecular weight of 366.41 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 167163889 |
| Molecular Formula | C16H30O9 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=CCCOCCOCCOCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C16H30O9/c17-3-1-4-20-6-8-22-10-12-24-14-15-25-13-11-23-9-7-21-5-2-16(18)19/h3H,1-2,4-15H2,(H,18,19) |
| InChIKey | RHQOGDMXKYNKBD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|