C18H33NO11 — CID 156637660
3-[2,2-bis(2-carboxyethoxymethyl)-3-(3-oxopropoxy)propoxy]propanoic acid;methanamine (PubChem CID 156637660) has the molecular formula C18H33NO11 and a molecular weight of 439.46 g/mol. Its IUPAC name is 3-[2,2-bis(2-carboxyethoxymethyl)-3-(3-oxopropoxy)propoxy]propanoic acid;methanamine.
| Compound Name | 3-[2,2-bis(2-carboxyethoxymethyl)-3-(3-oxopropoxy)propoxy]propanoic acid;methanamine |
|---|---|
| PubChem CID | 156637660 |
| Molecular Formula | C18H33NO11 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[2,2-bis(2-carboxyethoxymethyl)-3-(3-oxopropoxy)propoxy]propanoic acid;methanamine |
| SMILES | CN.O=CCCOCC(COCCC(=O)O)(COCCC(=O)O)COCCC(=O)O |
| InChI | InChI=1S/C17H28O11.CH5N/c18-5-1-6-25-10-17(11-26-7-2-14(19)20,12-27-8-3-15(21)22)13-28-9-4-16(23)24;1-2/h5H,1-4,6-13H2,(H,19,20)(H,21,22)(H,23,24);2H2,1H3 |
| InChIKey | YWIHWQPNHUNDRW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|