C13H25NO5 — CID 88956294
3-[2-amino-2-(3-oxopropoxymethyl)-3-propoxypropoxy]propanal (PubChem CID 88956294) has the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. Its IUPAC name is 3-[2-amino-2-(3-oxopropoxymethyl)-3-propoxypropoxy]propanal.
| Compound Name | 3-[2-amino-2-(3-oxopropoxymethyl)-3-propoxypropoxy]propanal |
|---|---|
| PubChem CID | 88956294 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-[2-amino-2-(3-oxopropoxymethyl)-3-propoxypropoxy]propanal |
| SMILES | CCCOCC(N)(COCCC=O)COCCC=O |
| InChI | InChI=1S/C13H25NO5/c1-2-7-17-10-13(14,11-18-8-3-5-15)12-19-9-4-6-16/h5-6H,2-4,7-12,14H2,1H3 |
| InChIKey | AONXBMFDRIJQLR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|