C10H20O3 — CID 122463238
3-[2-(3-methylbutoxy)ethoxy]propanal (PubChem CID 122463238) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-[2-(3-methylbutoxy)ethoxy]propanal.
| Compound Name | 3-[2-(3-methylbutoxy)ethoxy]propanal |
|---|---|
| PubChem CID | 122463238 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 3-[2-(3-methylbutoxy)ethoxy]propanal |
| SMILES | CC(C)CCOCCOCCC=O |
| InChI | InChI=1S/C10H20O3/c1-10(2)4-7-13-9-8-12-6-3-5-11/h5,10H,3-4,6-9H2,1-2H3 |
| InChIKey | NCFOKIXAKPFHJX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|