C8H16O3 — CID 63040405
3-(2-propan-2-yloxyethoxy)propanal (PubChem CID 63040405) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 3-(2-propan-2-yloxyethoxy)propanal.
| Compound Name | 3-(2-propan-2-yloxyethoxy)propanal |
|---|---|
| PubChem CID | 63040405 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 3-(2-propan-2-yloxyethoxy)propanal |
| SMILES | CC(C)OCCOCCC=O |
| InChI | InChI=1S/C8H16O3/c1-8(2)11-7-6-10-5-3-4-9/h4,8H,3,5-7H2,1-2H3 |
| InChIKey | VRICUTZRJIMHMI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|