C15H30O7 — CID 123354844
3-[2-[3-(2-methoxyethoxy)-2-(2-methoxyethoxymethyl)propoxy]ethoxy]propanal (PubChem CID 123354844) has the molecular formula C15H30O7 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[2-[3-(2-methoxyethoxy)-2-(2-methoxyethoxymethyl)propoxy]ethoxy]propanal.
| Compound Name | 3-[2-[3-(2-methoxyethoxy)-2-(2-methoxyethoxymethyl)propoxy]ethoxy]propanal |
|---|---|
| PubChem CID | 123354844 |
| Molecular Formula | C15H30O7 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-[2-[3-(2-methoxyethoxy)-2-(2-methoxyethoxymethyl)propoxy]ethoxy]propanal |
| SMILES | COCCOCC(COCCOC)COCCOCCC=O |
| InChI | InChI=1S/C15H30O7/c1-17-6-8-20-12-15(13-21-9-7-18-2)14-22-11-10-19-5-3-4-16/h4,15H,3,5-14H2,1-2H3 |
| InChIKey | DQBIMTGNWNTTMA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|