About methane;4-methylpentanal
methane;4-methylpentanal (PubChem CID 87157049) has the molecular formula C7H16O
and a molecular weight of 116.20 g/mol. Its IUPAC name is methane;4-methylpentanal.
Molecular Properties
| Compound Name | methane;4-methylpentanal |
| PubChem CID | 87157049 |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.20 g/mol |
| Exact Mass | 116.12 |
| IUPAC Name | methane;4-methylpentanal |
| SMILES | C.CC(C)CCC=O |
| InChI | InChI=1S/C6H12O.CH4/c1-6(2)4-3-5-7;/h5-6H,3-4H2,1-2H3;1H4 |
| InChIKey | SABJPRABEDHOKQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;4-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methylpentanal?
The IUPAC name of methane;4-methylpentanal (CID 87157049) is methane;4-methylpentanal.
What is the SMILES notation for methane;4-methylpentanal?
The canonical SMILES for methane;4-methylpentanal is C.CC(C)CCC=O.
What is the InChIKey of methane;4-methylpentanal?
The InChIKey is SABJPRABEDHOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.CH4/c1-6(2)4-3-5-7;/h5-6H,3-4H2,1-2H3;1H4.
What are the key properties of methane;4-methylpentanal?
methane;4-methylpentanal has a molecular weight of 116.20 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methylpentanal is sourced from PubChem (CID 87157049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).