About 22-methyltricosanal
22-methyltricosanal (PubChem CID 86049143) has the molecular formula C24H48O
and a molecular weight of 352.65 g/mol. Its IUPAC name is 22-methyltricosanal.
Molecular Properties
| Compound Name | 22-methyltricosanal |
| PubChem CID | 86049143 |
| Molecular Formula | C24H48O |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.37 |
| IUPAC Name | 22-methyltricosanal |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCCCC=O |
| InChI | InChI=1S/C24H48O/c1-24(2)22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25/h23-24H,3-22H2,1-2H3 |
| InChIKey | UIBJQQLEWNKSHN-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 22-methyltricosanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 22-methyltricosanal?
The IUPAC name of 22-methyltricosanal (CID 86049143) is 22-methyltricosanal.
What is the SMILES notation for 22-methyltricosanal?
The canonical SMILES for 22-methyltricosanal is CC(C)CCCCCCCCCCCCCCCCCCCCC=O.
What is the InChIKey of 22-methyltricosanal?
The InChIKey is UIBJQQLEWNKSHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O/c1-24(2)22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25/h23-24H,3-22H2,1-2H3.
What are the key properties of 22-methyltricosanal?
22-methyltricosanal has a molecular weight of 352.65 g/mol, XLogP of 8.64, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 22-methyltricosanal is sourced from PubChem (CID 86049143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).