About 18-methylnonadecanal
18-methylnonadecanal (PubChem CID 22123977) has the molecular formula C20H40O
and a molecular weight of 296.54 g/mol. Its IUPAC name is 18-methylnonadecanal.
Molecular Properties
| Compound Name | 18-methylnonadecanal |
| PubChem CID | 22123977 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 18-methylnonadecanal |
| SMILES | CC(C)CCCCCCCCCCCCCCCCC=O |
| InChI | InChI=1S/C20H40O/c1-20(2)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21/h19-20H,3-18H2,1-2H3 |
| InChIKey | ZRCRFMSERFXESL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 18-methylnonadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-methylnonadecanal?
The IUPAC name of 18-methylnonadecanal (CID 22123977) is 18-methylnonadecanal.
What is the SMILES notation for 18-methylnonadecanal?
The canonical SMILES for 18-methylnonadecanal is CC(C)CCCCCCCCCCCCCCCCC=O.
What is the InChIKey of 18-methylnonadecanal?
The InChIKey is ZRCRFMSERFXESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O/c1-20(2)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21/h19-20H,3-18H2,1-2H3.
What are the key properties of 18-methylnonadecanal?
18-methylnonadecanal has a molecular weight of 296.54 g/mol, XLogP of 7.08, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 18-methylnonadecanal is sourced from PubChem (CID 22123977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).