About alumane;6-methylheptanal
alumane;6-methylheptanal (PubChem CID 174999973) has the molecular formula C8H19AlO
and a molecular weight of 158.22 g/mol. Its IUPAC name is alumane;6-methylheptanal.
Molecular Properties
| Compound Name | alumane;6-methylheptanal |
| PubChem CID | 174999973 |
| Molecular Formula | C8H19AlO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | alumane;6-methylheptanal |
| SMILES | CC(C)CCCCC=O.[AlH3] |
| InChI | InChI=1S/C8H16O.Al.3H/c1-8(2)6-4-3-5-7-9;;;;/h7-8H,3-6H2,1-2H3;;;; |
| InChIKey | IDQPQZMUNQRUCD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze alumane;6-methylheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;6-methylheptanal?
The IUPAC name of alumane;6-methylheptanal (CID 174999973) is alumane;6-methylheptanal.
What is the SMILES notation for alumane;6-methylheptanal?
The canonical SMILES for alumane;6-methylheptanal is CC(C)CCCCC=O.[AlH3].
What is the InChIKey of alumane;6-methylheptanal?
The InChIKey is IDQPQZMUNQRUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.Al.3H/c1-8(2)6-4-3-5-7-9;;;;/h7-8H,3-6H2,1-2H3;;;;.
What are the key properties of alumane;6-methylheptanal?
alumane;6-methylheptanal has a molecular weight of 158.22 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;6-methylheptanal is sourced from PubChem (CID 174999973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).