About methane;12-methyltridecanal
methane;12-methyltridecanal (PubChem CID 175307429) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is methane;12-methyltridecanal.
Molecular Properties
| Compound Name | methane;12-methyltridecanal |
| PubChem CID | 175307429 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | methane;12-methyltridecanal |
| SMILES | C.CC(C)CCCCCCCCCCC=O |
| InChI | InChI=1S/C14H28O.CH4/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15;/h13-14H,3-12H2,1-2H3;1H4 |
| InChIKey | ZKYFDWDHJRLXDD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;12-methyltridecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;12-methyltridecanal?
The IUPAC name of methane;12-methyltridecanal (CID 175307429) is methane;12-methyltridecanal.
What is the SMILES notation for methane;12-methyltridecanal?
The canonical SMILES for methane;12-methyltridecanal is C.CC(C)CCCCCCCCCCC=O.
What is the InChIKey of methane;12-methyltridecanal?
The InChIKey is ZKYFDWDHJRLXDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O.CH4/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15;/h13-14H,3-12H2,1-2H3;1H4.
What are the key properties of methane;12-methyltridecanal?
methane;12-methyltridecanal has a molecular weight of 228.42 g/mol, XLogP of 5.38, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;12-methyltridecanal is sourced from PubChem (CID 175307429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).