About 12-hydroxytridecanal
12-hydroxytridecanal (PubChem CID 11961599) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 12-hydroxytridecanal.
Molecular Properties
| Compound Name | 12-hydroxytridecanal |
| PubChem CID | 11961599 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 12-hydroxytridecanal |
| SMILES | CC(O)CCCCCCCCCCC=O |
| InChI | InChI=1S/C13H26O2/c1-13(15)11-9-7-5-3-2-4-6-8-10-12-14/h12-13,15H,2-11H2,1H3 |
| InChIKey | WLWURFYBTNGWCG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-hydroxytridecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroxytridecanal?
The IUPAC name of 12-hydroxytridecanal (CID 11961599) is 12-hydroxytridecanal.
What is the SMILES notation for 12-hydroxytridecanal?
The canonical SMILES for 12-hydroxytridecanal is CC(O)CCCCCCCCCCC=O.
What is the InChIKey of 12-hydroxytridecanal?
The InChIKey is WLWURFYBTNGWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-13(15)11-9-7-5-3-2-4-6-8-10-12-14/h12-13,15H,2-11H2,1H3.
What are the key properties of 12-hydroxytridecanal?
12-hydroxytridecanal has a molecular weight of 214.35 g/mol, XLogP of 3.47, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroxytridecanal is sourced from PubChem (CID 11961599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).