About 12-hydroxytetradecanal
12-hydroxytetradecanal (PubChem CID 90714775) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 12-hydroxytetradecanal.
Molecular Properties
| Compound Name | 12-hydroxytetradecanal |
| PubChem CID | 90714775 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 12-hydroxytetradecanal |
| SMILES | CCC(O)CCCCCCCCCCC=O |
| InChI | InChI=1S/C14H28O2/c1-2-14(16)12-10-8-6-4-3-5-7-9-11-13-15/h13-14,16H,2-12H2,1H3 |
| InChIKey | SAAXCFIDGJVWRT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-hydroxytetradecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroxytetradecanal?
The IUPAC name of 12-hydroxytetradecanal (CID 90714775) is 12-hydroxytetradecanal.
What is the SMILES notation for 12-hydroxytetradecanal?
The canonical SMILES for 12-hydroxytetradecanal is CCC(O)CCCCCCCCCCC=O.
What is the InChIKey of 12-hydroxytetradecanal?
The InChIKey is SAAXCFIDGJVWRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-2-14(16)12-10-8-6-4-3-5-7-9-11-13-15/h13-14,16H,2-12H2,1H3.
What are the key properties of 12-hydroxytetradecanal?
12-hydroxytetradecanal has a molecular weight of 228.38 g/mol, XLogP of 3.86, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroxytetradecanal is sourced from PubChem (CID 90714775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).