About 5-hydroxyoctanal
5-hydroxyoctanal (PubChem CID 54248840) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 5-hydroxyoctanal.
Molecular Properties
| Compound Name | 5-hydroxyoctanal |
| PubChem CID | 54248840 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 5-hydroxyoctanal |
| SMILES | CCCC(O)CCCC=O |
| InChI | InChI=1S/C8H16O2/c1-2-5-8(10)6-3-4-7-9/h7-8,10H,2-6H2,1H3 |
| InChIKey | QVGWQEOFNGJAOO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyoctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyoctanal?
The IUPAC name of 5-hydroxyoctanal (CID 54248840) is 5-hydroxyoctanal.
What is the SMILES notation for 5-hydroxyoctanal?
The canonical SMILES for 5-hydroxyoctanal is CCCC(O)CCCC=O.
What is the InChIKey of 5-hydroxyoctanal?
The InChIKey is QVGWQEOFNGJAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-2-5-8(10)6-3-4-7-9/h7-8,10H,2-6H2,1H3.
What are the key properties of 5-hydroxyoctanal?
5-hydroxyoctanal has a molecular weight of 144.21 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyoctanal is sourced from PubChem (CID 54248840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).