About magnesium;hydride;5-propyloctanal
magnesium;hydride;5-propyloctanal (PubChem CID 173415253) has the molecular formula C11H24MgO
and a molecular weight of 196.62 g/mol. Its IUPAC name is magnesium;hydride;5-propyloctanal.
Molecular Properties
| Compound Name | magnesium;hydride;5-propyloctanal |
| PubChem CID | 173415253 |
| Molecular Formula | C11H24MgO |
| Molecular Weight | 196.62 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | magnesium;hydride;5-propyloctanal |
| SMILES | CCCC(CCC)CCCC=O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C11H22O.Mg.2H/c1-3-7-11(8-4-2)9-5-6-10-12;;;/h10-11H,3-9H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | MZCUJARYZNCSOL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;5-propyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;5-propyloctanal?
The IUPAC name of magnesium;hydride;5-propyloctanal (CID 173415253) is magnesium;hydride;5-propyloctanal.
What is the SMILES notation for magnesium;hydride;5-propyloctanal?
The canonical SMILES for magnesium;hydride;5-propyloctanal is CCCC(CCC)CCCC=O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;5-propyloctanal?
The InChIKey is MZCUJARYZNCSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.Mg.2H/c1-3-7-11(8-4-2)9-5-6-10-12;;;/h10-11H,3-9H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;5-propyloctanal?
magnesium;hydride;5-propyloctanal has a molecular weight of 196.62 g/mol, XLogP of 3.42, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;5-propyloctanal is sourced from PubChem (CID 173415253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).