About (E)-10-propyldocos-5-ene
(E)-10-propyldocos-5-ene (PubChem CID 173194543) has the molecular formula C25H50
and a molecular weight of 350.68 g/mol. Its IUPAC name is (E)-10-propyldocos-5-ene.
Molecular Properties
| Compound Name | (E)-10-propyldocos-5-ene |
| PubChem CID | 173194543 |
| Molecular Formula | C25H50 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.39 |
| IUPAC Name | (E)-10-propyldocos-5-ene |
| SMILES | CCCC/C=C/CCCC(CCC)CCCCCCCCCCCC |
| InChI | InChI=1S/C25H50/c1-4-7-9-11-13-14-15-17-19-21-24-25(22-6-3)23-20-18-16-12-10-8-5-2/h12,16,25H,4-11,13-15,17-24H2,1-3H3/b16-12+ |
| InChIKey | CSKXBPRSQXHWJF-FOWTUZBSSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-10-propyldocos-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-10-propyldocos-5-ene?
The IUPAC name of (E)-10-propyldocos-5-ene (CID 173194543) is (E)-10-propyldocos-5-ene.
What is the SMILES notation for (E)-10-propyldocos-5-ene?
The canonical SMILES for (E)-10-propyldocos-5-ene is CCCC/C=C/CCCC(CCC)CCCCCCCCCCCC.
What is the InChIKey of (E)-10-propyldocos-5-ene?
The InChIKey is CSKXBPRSQXHWJF-FOWTUZBSSA-N. The full InChI is InChI=1S/C25H50/c1-4-7-9-11-13-14-15-17-19-21-24-25(22-6-3)23-20-18-16-12-10-8-5-2/h12,16,25H,4-11,13-15,17-24H2,1-3H3/b16-12+.
What are the key properties of (E)-10-propyldocos-5-ene?
(E)-10-propyldocos-5-ene has a molecular weight of 350.68 g/mol, XLogP of 9.63, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-10-propyldocos-5-ene is sourced from PubChem (CID 173194543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).