About 13-propylhenicos-9-ene
13-propylhenicos-9-ene (PubChem CID 175294626) has the molecular formula C24H48
and a molecular weight of 336.65 g/mol. Its IUPAC name is 13-propylhenicos-9-ene.
Molecular Properties
| Compound Name | 13-propylhenicos-9-ene |
| PubChem CID | 175294626 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 13-propylhenicos-9-ene |
| SMILES | CCCCCCCCC=CCCC(CCC)CCCCCCCC |
| InChI | InChI=1S/C24H48/c1-4-7-9-11-13-14-15-16-18-20-23-24(21-6-3)22-19-17-12-10-8-5-2/h16,18,24H,4-15,17,19-23H2,1-3H3 |
| InChIKey | VUCJUPBUFJWIAC-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 13-propylhenicos-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-propylhenicos-9-ene?
The IUPAC name of 13-propylhenicos-9-ene (CID 175294626) is 13-propylhenicos-9-ene.
What is the SMILES notation for 13-propylhenicos-9-ene?
The canonical SMILES for 13-propylhenicos-9-ene is CCCCCCCCC=CCCC(CCC)CCCCCCCC.
What is the InChIKey of 13-propylhenicos-9-ene?
The InChIKey is VUCJUPBUFJWIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48/c1-4-7-9-11-13-14-15-16-18-20-23-24(21-6-3)22-19-17-12-10-8-5-2/h16,18,24H,4-15,17,19-23H2,1-3H3.
What are the key properties of 13-propylhenicos-9-ene?
13-propylhenicos-9-ene has a molecular weight of 336.65 g/mol, XLogP of 9.24, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 13-propylhenicos-9-ene is sourced from PubChem (CID 175294626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).