About 4-butyloctanal;titanium
4-butyloctanal;titanium (PubChem CID 175088006) has the molecular formula C12H24OTi
and a molecular weight of 232.19 g/mol. Its IUPAC name is 4-butyloctanal;titanium.
Molecular Properties
| Compound Name | 4-butyloctanal;titanium |
| PubChem CID | 175088006 |
| Molecular Formula | C12H24OTi |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-butyloctanal;titanium |
| SMILES | CCCCC(CCC=O)CCCC.[Ti] |
| InChI | InChI=1S/C12H24O.Ti/c1-3-5-8-12(9-6-4-2)10-7-11-13;/h11-12H,3-10H2,1-2H3; |
| InChIKey | MNUNDIBUONTWOA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-butyloctanal;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyloctanal;titanium?
The IUPAC name of 4-butyloctanal;titanium (CID 175088006) is 4-butyloctanal;titanium.
What is the SMILES notation for 4-butyloctanal;titanium?
The canonical SMILES for 4-butyloctanal;titanium is CCCCC(CCC=O)CCCC.[Ti].
What is the InChIKey of 4-butyloctanal;titanium?
The InChIKey is MNUNDIBUONTWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O.Ti/c1-3-5-8-12(9-6-4-2)10-7-11-13;/h11-12H,3-10H2,1-2H3;.
What are the key properties of 4-butyloctanal;titanium?
4-butyloctanal;titanium has a molecular weight of 232.19 g/mol, XLogP of 3.96, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyloctanal;titanium is sourced from PubChem (CID 175088006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).