About 9-amino-5-propylnonanal
9-amino-5-propylnonanal (PubChem CID 151747721) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 9-amino-5-propylnonanal.
Molecular Properties
| Compound Name | 9-amino-5-propylnonanal |
| PubChem CID | 151747721 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 9-amino-5-propylnonanal |
| SMILES | CCCC(CCCC=O)CCCCN |
| InChI | InChI=1S/C12H25NO/c1-2-7-12(8-3-5-10-13)9-4-6-11-14/h11-12H,2-10,13H2,1H3 |
| InChIKey | RNWBGYKKUJXGAZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-5-propylnonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-5-propylnonanal?
The IUPAC name of 9-amino-5-propylnonanal (CID 151747721) is 9-amino-5-propylnonanal.
What is the SMILES notation for 9-amino-5-propylnonanal?
The canonical SMILES for 9-amino-5-propylnonanal is CCCC(CCCC=O)CCCCN.
What is the InChIKey of 9-amino-5-propylnonanal?
The InChIKey is RNWBGYKKUJXGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-2-7-12(8-3-5-10-13)9-4-6-11-14/h11-12H,2-10,13H2,1H3.
What are the key properties of 9-amino-5-propylnonanal?
9-amino-5-propylnonanal has a molecular weight of 199.34 g/mol, XLogP of 2.90, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-5-propylnonanal is sourced from PubChem (CID 151747721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).