About 8-aminooctanal;7-methoxytetradecane;propane
8-aminooctanal;7-methoxytetradecane;propane (PubChem CID 168894528) has the molecular formula C26H57NO2
and a molecular weight of 415.75 g/mol. Its IUPAC name is 8-aminooctanal;7-methoxytetradecane;propane.
Molecular Properties
| Compound Name | 8-aminooctanal;7-methoxytetradecane;propane |
| PubChem CID | 168894528 |
| Molecular Formula | C26H57NO2 |
| Molecular Weight | 415.75 g/mol |
| Exact Mass | 415.44 |
| IUPAC Name | 8-aminooctanal;7-methoxytetradecane;propane |
| SMILES | CCC.CCCCCCCC(CCCCCC)OC.NCCCCCCCC=O |
| InChI | InChI=1S/C15H32O.C8H17NO.C3H8/c1-4-6-8-10-12-14-15(16-3)13-11-9-7-5-2;9-7-5-3-1-2-4-6-8-10;1-3-2/h15H,4-14H2,1-3H3;8H,1-7,9H2;3H2,1-2H3 |
| InChIKey | IXDAZZYWVHEZJH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.75 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-aminooctanal;7-methoxytetradecane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminooctanal;7-methoxytetradecane;propane?
The IUPAC name of 8-aminooctanal;7-methoxytetradecane;propane (CID 168894528) is 8-aminooctanal;7-methoxytetradecane;propane.
What is the SMILES notation for 8-aminooctanal;7-methoxytetradecane;propane?
The canonical SMILES for 8-aminooctanal;7-methoxytetradecane;propane is CCC.CCCCCCCC(CCCCCC)OC.NCCCCCCCC=O.
What is the InChIKey of 8-aminooctanal;7-methoxytetradecane;propane?
The InChIKey is IXDAZZYWVHEZJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O.C8H17NO.C3H8/c1-4-6-8-10-12-14-15(16-3)13-11-9-7-5-2;9-7-5-3-1-2-4-6-8-10;1-3-2/h15H,4-14H2,1-3H3;8H,1-7,9H2;3H2,1-2H3.
What are the key properties of 8-aminooctanal;7-methoxytetradecane;propane?
8-aminooctanal;7-methoxytetradecane;propane has a molecular weight of 415.75 g/mol, XLogP of 8.23, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminooctanal;7-methoxytetradecane;propane is sourced from PubChem (CID 168894528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).