C18H36O2 — CID 89328710
12-methoxy-7,7-dimethylpentadecanal (PubChem CID 89328710) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 12-methoxy-7,7-dimethylpentadecanal.
| Compound Name | 12-methoxy-7,7-dimethylpentadecanal |
|---|---|
| PubChem CID | 89328710 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 12-methoxy-7,7-dimethylpentadecanal |
| SMILES | CCCC(CCCCC(C)(C)CCCCCC=O)OC |
| InChI | InChI=1S/C18H36O2/c1-5-12-17(20-4)13-8-10-15-18(2,3)14-9-6-7-11-16-19/h16-17H,5-15H2,1-4H3 |
| InChIKey | TYIBAOYZUCIKNC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|