About (5S)-5-methoxyundecane
(5S)-5-methoxyundecane (PubChem CID 118889956) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is (5S)-5-methoxyundecane.
Molecular Properties
| Compound Name | (5S)-5-methoxyundecane |
| PubChem CID | 118889956 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | (5S)-5-methoxyundecane |
| SMILES | CCCCCC[C@H](CCCC)OC |
| InChI | InChI=1S/C12H26O/c1-4-6-8-9-11-12(13-3)10-7-5-2/h12H,4-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | OUCWPBCSURGMLZ-LBPRGKRZSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-methoxyundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methoxyundecane?
The IUPAC name of (5S)-5-methoxyundecane (CID 118889956) is (5S)-5-methoxyundecane.
What is the SMILES notation for (5S)-5-methoxyundecane?
The canonical SMILES for (5S)-5-methoxyundecane is CCCCCC[C@H](CCCC)OC.
What is the InChIKey of (5S)-5-methoxyundecane?
The InChIKey is OUCWPBCSURGMLZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H26O/c1-4-6-8-9-11-12(13-3)10-7-5-2/h12H,4-11H2,1-3H3/t12-/m0/s1.
What are the key properties of (5S)-5-methoxyundecane?
(5S)-5-methoxyundecane has a molecular weight of 186.34 g/mol, XLogP of 4.16, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methoxyundecane is sourced from PubChem (CID 118889956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).